C16H36N2 — CID 140667083
1-N,1-N,6-N,6-N,4,4,5,5,6-nonamethylheptane-1,6-diamine (PubChem CID 140667083) has the molecular formula C16H36N2 and a molecular weight of 256.48 g/mol. Its IUPAC name is 1-N,1-N,6-N,6-N,4,4,5,5,6-nonamethylheptane-1,6-diamine.
| Compound Name | 1-N,1-N,6-N,6-N,4,4,5,5,6-nonamethylheptane-1,6-diamine |
|---|---|
| PubChem CID | 140667083 |
| Molecular Formula | C16H36N2 |
| Molecular Weight | 256.48 g/mol |
| Exact Mass | 256.29 |
| IUPAC Name | 1-N,1-N,6-N,6-N,4,4,5,5,6-nonamethylheptane-1,6-diamine |
| SMILES | CN(C)CCCC(C)(C)C(C)(C)C(C)(C)N(C)C |
| InChI | InChI=1S/C16H36N2/c1-14(2,12-11-13-17(7)8)15(3,4)16(5,6)18(9)10/h11-13H2,1-10H3 |
| InChIKey | YZQWVHQGSVVAKJ-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.48 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |