C13H22F6NO3P — CID 140667522
[2,2,6,6-tetramethyl-4,4-bis(2,2,2-trifluoroethyl)piperidin-1-yl]phosphonic acid (PubChem CID 140667522) has the molecular formula C13H22F6NO3P and a molecular weight of 385.29 g/mol. Its IUPAC name is [2,2,6,6-tetramethyl-4,4-bis(2,2,2-trifluoroethyl)piperidin-1-yl]phosphonic acid.
| Compound Name | [2,2,6,6-tetramethyl-4,4-bis(2,2,2-trifluoroethyl)piperidin-1-yl]phosphonic acid |
|---|---|
| PubChem CID | 140667522 |
| Molecular Formula | C13H22F6NO3P |
| Molecular Weight | 385.29 g/mol |
| Exact Mass | 385.12 |
| IUPAC Name | [2,2,6,6-tetramethyl-4,4-bis(2,2,2-trifluoroethyl)piperidin-1-yl]phosphonic acid |
| SMILES | CC1(C)CC(CC(F)(F)F)(CC(F)(F)F)CC(C)(C)N1P(=O)(O)O |
| InChI | InChI=1S/C13H22F6NO3P/c1-9(2)5-11(7-12(14,15)16,8-13(17,18)19)6-10(3,4)20(9)24(21,22)23/h5-8H2,1-4H3,(H2,21,22,23) |
| InChIKey | SGYJSFSYDLZXEX-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.29 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|