About tert-butyl N-[(3S,5R)-3-(4-amino-1-methylpyrazol-5-yl)-5-(trifluoromethyl)piperidin-3-yl]carbamate
tert-butyl N-[(3S,5R)-3-(4-amino-1-methylpyrazol-5-yl)-5-(trifluoromethyl)piperidin-3-yl]carbamate (PubChem CID 140667668) has the molecular formula C15H24F3N5O2
and a molecular weight of 363.38 g/mol. Its IUPAC name is tert-butyl N-[(3S,5R)-3-(4-amino-1-methylpyrazol-5-yl)-5-(trifluoromethyl)piperidin-3-yl]carbamate.
Molecular Properties
| Compound Name | tert-butyl N-[(3S,5R)-3-(4-amino-1-methylpyrazol-5-yl)-5-(trifluoromethyl)piperidin-3-yl]carbamate |
| PubChem CID | 140667668 |
| Molecular Formula | C15H24F3N5O2 |
| Molecular Weight | 363.38 g/mol |
| Exact Mass | 363.19 |
| IUPAC Name | tert-butyl N-[(3S,5R)-3-(4-amino-1-methylpyrazol-5-yl)-5-(trifluoromethyl)piperidin-3-yl]carbamate |
| SMILES | Cn1ncc(N)c1[C@@]1(NC(=O)OC(C)(C)C)CNC[C@H](C(F)(F)F)C1 |
| InChI | InChI=1S/C15H24F3N5O2/c1-13(2,3)25-12(24)22-14(11-10(19)7-21-23(11)4)5-9(6-20-8-14)15(16,17)18/h7,9,20H,5-6,8,19H2,1-4H3,(H,22,24)/t9-,14+/m1/s1 |
| InChIKey | CHCOOZIZZQJZHP-OTYXRUKQSA-N |
| XLogP | 1.89 |
| TPSA | 94.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 363.38 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze tert-butyl N-[(3S,5R)-3-(4-amino-1-methylpyrazol-5-yl)-5-(trifluoromethyl)piperidin-3-yl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl N-[(3S,5R)-3-(4-amino-1-methylpyrazol-5-yl)-5-(trifluoromethyl)piperidin-3-yl]carbamate?
The IUPAC name of tert-butyl N-[(3S,5R)-3-(4-amino-1-methylpyrazol-5-yl)-5-(trifluoromethyl)piperidin-3-yl]carbamate (CID 140667668) is tert-butyl N-[(3S,5R)-3-(4-amino-1-methylpyrazol-5-yl)-5-(trifluoromethyl)piperidin-3-yl]carbamate.
What is the SMILES notation for tert-butyl N-[(3S,5R)-3-(4-amino-1-methylpyrazol-5-yl)-5-(trifluoromethyl)piperidin-3-yl]carbamate?
The canonical SMILES for tert-butyl N-[(3S,5R)-3-(4-amino-1-methylpyrazol-5-yl)-5-(trifluoromethyl)piperidin-3-yl]carbamate is Cn1ncc(N)c1[C@@]1(NC(=O)OC(C)(C)C)CNC[C@H](C(F)(F)F)C1.
What is the InChIKey of tert-butyl N-[(3S,5R)-3-(4-amino-1-methylpyrazol-5-yl)-5-(trifluoromethyl)piperidin-3-yl]carbamate?
The InChIKey is CHCOOZIZZQJZHP-OTYXRUKQSA-N. The full InChI is InChI=1S/C15H24F3N5O2/c1-13(2,3)25-12(24)22-14(11-10(19)7-21-23(11)4)5-9(6-20-8-14)15(16,17)18/h7,9,20H,5-6,8,19H2,1-4H3,(H,22,24)/t9-,14+/m1/s1.
What are the key properties of tert-butyl N-[(3S,5R)-3-(4-amino-1-methylpyrazol-5-yl)-5-(trifluoromethyl)piperidin-3-yl]carbamate?
tert-butyl N-[(3S,5R)-3-(4-amino-1-methylpyrazol-5-yl)-5-(trifluoromethyl)piperidin-3-yl]carbamate has a molecular weight of 363.38 g/mol, XLogP of 1.89, 2 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl N-[(3S,5R)-3-(4-amino-1-methylpyrazol-5-yl)-5-(trifluoromethyl)piperidin-3-yl]carbamate is sourced from PubChem (CID 140667668), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).