C21H22F6N2O6 — CID 140667746
(2,2,2-trifluoroacetyl) 4-[(3S)-1-methylpyrrolidin-3-yl]oxy-2-[oxan-4-yl-(2,2,2-trifluoroacetyl)amino]benzoate (PubChem CID 140667746) has the molecular formula C21H22F6N2O6 and a molecular weight of 512.40 g/mol. Its IUPAC name is (2,2,2-trifluoroacetyl) 4-[(3S)-1-methylpyrrolidin-3-yl]oxy-2-[oxan-4-yl-(2,2,2-trifluoroacetyl)amino]benzoate.
| Compound Name | (2,2,2-trifluoroacetyl) 4-[(3S)-1-methylpyrrolidin-3-yl]oxy-2-[oxan-4-yl-(2,2,2-trifluoroacetyl)amino]benzoate |
|---|---|
| PubChem CID | 140667746 |
| Molecular Formula | C21H22F6N2O6 |
| Molecular Weight | 512.40 g/mol |
| Exact Mass | 512.14 |
| IUPAC Name | (2,2,2-trifluoroacetyl) 4-[(3S)-1-methylpyrrolidin-3-yl]oxy-2-[oxan-4-yl-(2,2,2-trifluoroacetyl)amino]benzoate |
| SMILES | CN1CC[C@H](Oc2ccc(C(=O)OC(=O)C(F)(F)F)c(N(C(=O)C(F)(F)F)C3CCOCC3)c2)C1 |
| InChI | InChI=1S/C21H22F6N2O6/c1-28-7-4-14(11-28)34-13-2-3-15(17(30)35-19(32)21(25,26)27)16(10-13)29(18(31)20(22,23)24)12-5-8-33-9-6-12/h2-3,10,12,14H,4-9,11H2,1H3/t14-/m0/s1 |
| InChIKey | YQYXZZGTBJVUJR-AWEZNQCLSA-N |
| XLogP | 3.09 |
| TPSA | 85.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.40 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|