C14H18N2O3S — CID 140667913
5-[(E)-3-(2-methoxycyclohexyl)prop-2-enylidene]-2-sulfanylidene-1,3-diazinane-4,6-dione (PubChem CID 140667913) has the molecular formula C14H18N2O3S and a molecular weight of 294.38 g/mol. Its IUPAC name is 5-[(E)-3-(2-methoxycyclohexyl)prop-2-enylidene]-2-sulfanylidene-1,3-diazinane-4,6-dione.
| Compound Name | 5-[(E)-3-(2-methoxycyclohexyl)prop-2-enylidene]-2-sulfanylidene-1,3-diazinane-4,6-dione |
|---|---|
| PubChem CID | 140667913 |
| Molecular Formula | C14H18N2O3S |
| Molecular Weight | 294.38 g/mol |
| Exact Mass | 294.10 |
| IUPAC Name | 5-[(E)-3-(2-methoxycyclohexyl)prop-2-enylidene]-2-sulfanylidene-1,3-diazinane-4,6-dione |
| SMILES | COC1CCCCC1/C=C/C=C1C(=O)NC(=S)NC1=O |
| InChI | InChI=1S/C14H18N2O3S/c1-19-11-8-3-2-5-9(11)6-4-7-10-12(17)15-14(20)16-13(10)18/h4,6-7,9,11H,2-3,5,8H2,1H3,(H2,15,16,17,18,20)/b6-4+ |
| InChIKey | ATVIFIMMXXGIGV-GQCTYLIASA-N |
| XLogP | 1.21 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.38 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|