C19H29N3O2S — CID 140667925
5-[(E)-3-[4-(dimethylamino)cyclohexyl]prop-2-enylidene]-1,3-diethyl-2-sulfanylidene-1,3-diazinane-4,6-dione (PubChem CID 140667925) has the molecular formula C19H29N3O2S and a molecular weight of 363.53 g/mol. Its IUPAC name is 5-[(E)-3-[4-(dimethylamino)cyclohexyl]prop-2-enylidene]-1,3-diethyl-2-sulfanylidene-1,3-diazinane-4,6-dione.
| Compound Name | 5-[(E)-3-[4-(dimethylamino)cyclohexyl]prop-2-enylidene]-1,3-diethyl-2-sulfanylidene-1,3-diazinane-4,6-dione |
|---|---|
| PubChem CID | 140667925 |
| Molecular Formula | C19H29N3O2S |
| Molecular Weight | 363.53 g/mol |
| Exact Mass | 363.20 |
| IUPAC Name | 5-[(E)-3-[4-(dimethylamino)cyclohexyl]prop-2-enylidene]-1,3-diethyl-2-sulfanylidene-1,3-diazinane-4,6-dione |
| SMILES | CCN1C(=O)C(=C/C=C/C2CCC(N(C)C)CC2)C(=O)N(CC)C1=S |
| InChI | InChI=1S/C19H29N3O2S/c1-5-21-17(23)16(18(24)22(6-2)19(21)25)9-7-8-14-10-12-15(13-11-14)20(3)4/h7-9,14-15H,5-6,10-13H2,1-4H3/b8-7+ |
| InChIKey | YCEKTIIUFKXPDU-BQYQJAHWSA-N |
| XLogP | 2.58 |
| TPSA | 43.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.53 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|