C14H18N2O3 — CID 140667929
5-[(E)-3-(4-methylcyclohexyl)prop-2-enylidene]-1,3-diazinane-2,4,6-trione (PubChem CID 140667929) has the molecular formula C14H18N2O3 and a molecular weight of 262.31 g/mol. Its IUPAC name is 5-[(E)-3-(4-methylcyclohexyl)prop-2-enylidene]-1,3-diazinane-2,4,6-trione.
| Compound Name | 5-[(E)-3-(4-methylcyclohexyl)prop-2-enylidene]-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 140667929 |
| Molecular Formula | C14H18N2O3 |
| Molecular Weight | 262.31 g/mol |
| Exact Mass | 262.13 |
| IUPAC Name | 5-[(E)-3-(4-methylcyclohexyl)prop-2-enylidene]-1,3-diazinane-2,4,6-trione |
| SMILES | CC1CCC(/C=C/C=C2C(=O)NC(=O)NC2=O)CC1 |
| InChI | InChI=1S/C14H18N2O3/c1-9-5-7-10(8-6-9)3-2-4-11-12(17)15-14(19)16-13(11)18/h2-4,9-10H,5-8H2,1H3,(H2,15,16,17,18,19)/b3-2+ |
| InChIKey | PYEHZBZFTNJLFE-NSCUHMNNSA-N |
| XLogP | 1.66 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.31 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|