C14H15N3O2S — CID 140667944
4-[(E)-3-(4,6-dioxo-2-sulfanylidene-1,3-diazinan-5-ylidene)prop-1-enyl]cyclohexane-1-carbonitrile (PubChem CID 140667944) has the molecular formula C14H15N3O2S and a molecular weight of 289.36 g/mol. Its IUPAC name is 4-[(E)-3-(4,6-dioxo-2-sulfanylidene-1,3-diazinan-5-ylidene)prop-1-enyl]cyclohexane-1-carbonitrile.
| Compound Name | 4-[(E)-3-(4,6-dioxo-2-sulfanylidene-1,3-diazinan-5-ylidene)prop-1-enyl]cyclohexane-1-carbonitrile |
|---|---|
| PubChem CID | 140667944 |
| Molecular Formula | C14H15N3O2S |
| Molecular Weight | 289.36 g/mol |
| Exact Mass | 289.09 |
| IUPAC Name | 4-[(E)-3-(4,6-dioxo-2-sulfanylidene-1,3-diazinan-5-ylidene)prop-1-enyl]cyclohexane-1-carbonitrile |
| SMILES | N#CC1CCC(/C=C/C=C2C(=O)NC(=S)NC2=O)CC1 |
| InChI | InChI=1S/C14H15N3O2S/c15-8-10-6-4-9(5-7-10)2-1-3-11-12(18)16-14(20)17-13(11)19/h1-3,9-10H,4-7H2,(H2,16,17,18,19,20)/b2-1+ |
| InChIKey | WUFHGKQVSZNQHR-OWOJBTEDSA-N |
| XLogP | 1.33 |
| TPSA | 81.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.36 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|