C21H44O — CID 140668394
2,4,6,12-tetramethylheptadecan-9-ol (PubChem CID 140668394) has the molecular formula C21H44O and a molecular weight of 312.58 g/mol. Its IUPAC name is 2,4,6,12-tetramethylheptadecan-9-ol.
| Compound Name | 2,4,6,12-tetramethylheptadecan-9-ol |
|---|---|
| PubChem CID | 140668394 |
| Molecular Formula | C21H44O |
| Molecular Weight | 312.58 g/mol |
| Exact Mass | 312.34 |
| IUPAC Name | 2,4,6,12-tetramethylheptadecan-9-ol |
| SMILES | CCCCCC(C)CCC(O)CCC(C)CC(C)CC(C)C |
| InChI | InChI=1S/C21H44O/c1-7-8-9-10-18(4)11-13-21(22)14-12-19(5)16-20(6)15-17(2)3/h17-22H,7-16H2,1-6H3 |
| InChIKey | MGVDKRQULGURNM-UHFFFAOYSA-N |
| XLogP | 6.83 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.58 |
| LogP ≤ 5 | 6.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|