C17H42N3S+3 — CID 140668451
3-[dimethyl(3-methylsulfanylpropyl)azaniumyl]propyl-dimethyl-[3-(trimethylazaniumyl)propyl]azanium (PubChem CID 140668451) has the molecular formula C17H42N3S+3 and a molecular weight of 320.61 g/mol. Its IUPAC name is 3-[dimethyl(3-methylsulfanylpropyl)azaniumyl]propyl-dimethyl-[3-(trimethylazaniumyl)propyl]azanium.
| Compound Name | 3-[dimethyl(3-methylsulfanylpropyl)azaniumyl]propyl-dimethyl-[3-(trimethylazaniumyl)propyl]azanium |
|---|---|
| PubChem CID | 140668451 |
| Molecular Formula | C17H42N3S+3 |
| Molecular Weight | 320.61 g/mol |
| Exact Mass | 320.31 |
| IUPAC Name | 3-[dimethyl(3-methylsulfanylpropyl)azaniumyl]propyl-dimethyl-[3-(trimethylazaniumyl)propyl]azanium |
| SMILES | CSCCC[N+](C)(C)CCC[N+](C)(C)CCC[N+](C)(C)C |
| InChI | InChI=1S/C17H42N3S/c1-18(2,3)12-9-13-19(4,5)14-10-15-20(6,7)16-11-17-21-8/h9-17H2,1-8H3/q+3 |
| InChIKey | AFBMYHNFVCJCFT-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.61 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|