C33H34Cl2F3N7O3 — CID 140669379
ethyl (3S)-8-[2-amino-6-[(1R)-1-[4-(3,5-dichlorophenyl)-2-(3-methylpyrazol-1-yl)phenyl]-2,2,2-trifluoroethoxy]pyrimidin-4-yl]-2,8-diazaspiro[4.5]decane-3-carboxylate (PubChem CID 140669379) has the molecular formula C33H34Cl2F3N7O3 and a molecular weight of 704.58 g/mol. Its IUPAC name is ethyl (3S)-8-[2-amino-6-[(1R)-1-[4-(3,5-dichlorophenyl)-2-(3-methylpyrazol-1-yl)phenyl]-2,2,2-trifluoroethoxy]pyrimidin-4-yl]-2,8-diazaspiro[4.5]decane-3-carboxylate.
| Compound Name | ethyl (3S)-8-[2-amino-6-[(1R)-1-[4-(3,5-dichlorophenyl)-2-(3-methylpyrazol-1-yl)phenyl]-2,2,2-trifluoroethoxy]pyrimidin-4-yl]-2,8-diazaspiro[4.5]decane-3-carboxylate |
|---|---|
| PubChem CID | 140669379 |
| Molecular Formula | C33H34Cl2F3N7O3 |
| Molecular Weight | 704.58 g/mol |
| Exact Mass | 703.21 |
| IUPAC Name | ethyl (3S)-8-[2-amino-6-[(1R)-1-[4-(3,5-dichlorophenyl)-2-(3-methylpyrazol-1-yl)phenyl]-2,2,2-trifluoroethoxy]pyrimidin-4-yl]-2,8-diazaspiro[4.5]decane-3-carboxylate |
| SMILES | CCOC(=O)[C@@H]1CC2(CCN(c3cc(O[C@H](c4ccc(-c5cc(Cl)cc(Cl)c5)cc4-n4ccc(C)n4)C(F)(F)F)nc(N)n3)CC2)CN1 |
| InChI | InChI=1S/C33H34Cl2F3N7O3/c1-3-47-30(46)25-17-32(18-40-25)7-10-44(11-8-32)27-16-28(42-31(39)41-27)48-29(33(36,37)38)24-5-4-20(21-12-22(34)15-23(35)13-21)14-26(24)45-9-6-19(2)43-45/h4-6,9,12-16,25,29,40H,3,7-8,10-11,17-18H2,1-2H3,(H2,39,41,42)/t25-,29+/m0/s1 |
| InChIKey | JWXBFPGORKFWHA-ABYGYWHVSA-N |
| XLogP | 6.72 |
| TPSA | 120.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 704.58 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |