C16H14N4O2 — CID 140669621
N-[[3-(5-oxo-3-phenyl-4H-1,2,4-triazol-1-yl)phenyl]methyl]formamide (PubChem CID 140669621) has the molecular formula C16H14N4O2 and a molecular weight of 294.31 g/mol. Its IUPAC name is N-[[3-(5-oxo-3-phenyl-4H-1,2,4-triazol-1-yl)phenyl]methyl]formamide.
| Compound Name | N-[[3-(5-oxo-3-phenyl-4H-1,2,4-triazol-1-yl)phenyl]methyl]formamide |
|---|---|
| PubChem CID | 140669621 |
| Molecular Formula | C16H14N4O2 |
| Molecular Weight | 294.31 g/mol |
| Exact Mass | 294.11 |
| IUPAC Name | N-[[3-(5-oxo-3-phenyl-4H-1,2,4-triazol-1-yl)phenyl]methyl]formamide |
| SMILES | O=CNCc1cccc(-n2nc(-c3ccccc3)[nH]c2=O)c1 |
| InChI | InChI=1S/C16H14N4O2/c21-11-17-10-12-5-4-8-14(9-12)20-16(22)18-15(19-20)13-6-2-1-3-7-13/h1-9,11H,10H2,(H,17,21)(H,18,19,22) |
| InChIKey | OUWZOGFZJVJIMT-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 79.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.31 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|