C17H13F4O4S2- — CID 140670051
4-[3-(4-ethenylphenoxy)propylsulfanyl]-2,3,5,6-tetrafluorobenzenesulfonate (PubChem CID 140670051) has the molecular formula C17H13F4O4S2- and a molecular weight of 421.41 g/mol. Its IUPAC name is 4-[3-(4-ethenylphenoxy)propylsulfanyl]-2,3,5,6-tetrafluorobenzenesulfonate.
| Compound Name | 4-[3-(4-ethenylphenoxy)propylsulfanyl]-2,3,5,6-tetrafluorobenzenesulfonate |
|---|---|
| PubChem CID | 140670051 |
| Molecular Formula | C17H13F4O4S2- |
| Molecular Weight | 421.41 g/mol |
| Exact Mass | 421.02 |
| IUPAC Name | 4-[3-(4-ethenylphenoxy)propylsulfanyl]-2,3,5,6-tetrafluorobenzenesulfonate |
| SMILES | C=Cc1ccc(OCCCSc2c(F)c(F)c(S(=O)(=O)[O-])c(F)c2F)cc1 |
| InChI | InChI=1S/C17H14F4O4S2/c1-2-10-4-6-11(7-5-10)25-8-3-9-26-16-12(18)14(20)17(27(22,23)24)15(21)13(16)19/h2,4-7H,1,3,8-9H2,(H,22,23,24)/p-1 |
| InChIKey | XSJZTIZXYOOXHG-UHFFFAOYSA-M |
| XLogP | 4.35 |
| TPSA | 66.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.41 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|