C18H32O4Si — CID 140671894
methyl (3aS,4S,7aS)-1-[tert-butyl(dimethyl)silyl]oxy-7a-methyl-5-oxo-2,3,3a,4,6,7-hexahydro-1H-indene-4-carboxylate (PubChem CID 140671894) has the molecular formula C18H32O4Si and a molecular weight of 340.54 g/mol. Its IUPAC name is methyl (3aS,4S,7aS)-1-[tert-butyl(dimethyl)silyl]oxy-7a-methyl-5-oxo-2,3,3a,4,6,7-hexahydro-1H-indene-4-carboxylate.
| Compound Name | methyl (3aS,4S,7aS)-1-[tert-butyl(dimethyl)silyl]oxy-7a-methyl-5-oxo-2,3,3a,4,6,7-hexahydro-1H-indene-4-carboxylate |
|---|---|
| PubChem CID | 140671894 |
| Molecular Formula | C18H32O4Si |
| Molecular Weight | 340.54 g/mol |
| Exact Mass | 340.21 |
| IUPAC Name | methyl (3aS,4S,7aS)-1-[tert-butyl(dimethyl)silyl]oxy-7a-methyl-5-oxo-2,3,3a,4,6,7-hexahydro-1H-indene-4-carboxylate |
| SMILES | COC(=O)[C@@H]1C(=O)CC[C@]2(C)C(O[Si](C)(C)C(C)(C)C)CC[C@@H]12 |
| InChI | InChI=1S/C18H32O4Si/c1-17(2,3)23(6,7)22-14-9-8-12-15(16(20)21-5)13(19)10-11-18(12,14)4/h12,14-15H,8-11H2,1-7H3/t12-,14?,15-,18-/m0/s1 |
| InChIKey | BAJFSRICEXDZCG-UJILACHPSA-N |
| XLogP | 3.95 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.54 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|