About 3-butanoyloxy-1,1,2-trifluoropropane-1-sulfonate
3-butanoyloxy-1,1,2-trifluoropropane-1-sulfonate (PubChem CID 140671962) has the molecular formula C7H10F3O5S-
and a molecular weight of 263.21 g/mol. Its IUPAC name is 3-butanoyloxy-1,1,2-trifluoropropane-1-sulfonate.
Molecular Properties
| Compound Name | 3-butanoyloxy-1,1,2-trifluoropropane-1-sulfonate |
| PubChem CID | 140671962 |
| Molecular Formula | C7H10F3O5S- |
| Molecular Weight | 263.21 g/mol |
| Exact Mass | 263.02 |
| IUPAC Name | 3-butanoyloxy-1,1,2-trifluoropropane-1-sulfonate |
| SMILES | CCCC(=O)OCC(F)C(F)(F)S(=O)(=O)[O-] |
| InChI | InChI=1S/C7H11F3O5S/c1-2-3-6(11)15-4-5(8)7(9,10)16(12,13)14/h5H,2-4H2,1H3,(H,12,13,14)/p-1 |
| InChIKey | SRRYCIRAPVWILX-UHFFFAOYSA-M |
| XLogP | 0.81 |
| TPSA | 83.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 263.21 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze 3-butanoyloxy-1,1,2-trifluoropropane-1-sulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-butanoyloxy-1,1,2-trifluoropropane-1-sulfonate?
The IUPAC name of 3-butanoyloxy-1,1,2-trifluoropropane-1-sulfonate (CID 140671962) is 3-butanoyloxy-1,1,2-trifluoropropane-1-sulfonate.
What is the SMILES notation for 3-butanoyloxy-1,1,2-trifluoropropane-1-sulfonate?
The canonical SMILES for 3-butanoyloxy-1,1,2-trifluoropropane-1-sulfonate is CCCC(=O)OCC(F)C(F)(F)S(=O)(=O)[O-].
What is the InChIKey of 3-butanoyloxy-1,1,2-trifluoropropane-1-sulfonate?
The InChIKey is SRRYCIRAPVWILX-UHFFFAOYSA-M. The full InChI is InChI=1S/C7H11F3O5S/c1-2-3-6(11)15-4-5(8)7(9,10)16(12,13)14/h5H,2-4H2,1H3,(H,12,13,14)/p-1.
What are the key properties of 3-butanoyloxy-1,1,2-trifluoropropane-1-sulfonate?
3-butanoyloxy-1,1,2-trifluoropropane-1-sulfonate has a molecular weight of 263.21 g/mol, XLogP of 0.81, 6 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-butanoyloxy-1,1,2-trifluoropropane-1-sulfonate is sourced from PubChem (CID 140671962), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).