C20H22N4O6S2 — CID 140672522
N-[3-[1-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-5-nitropyrrol-3-yl]prop-2-ynyl]-3-(pyridin-2-yldisulfanyl)propanamide (PubChem CID 140672522) has the molecular formula C20H22N4O6S2 and a molecular weight of 478.55 g/mol. Its IUPAC name is N-[3-[1-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-5-nitropyrrol-3-yl]prop-2-ynyl]-3-(pyridin-2-yldisulfanyl)propanamide.
| Compound Name | N-[3-[1-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-5-nitropyrrol-3-yl]prop-2-ynyl]-3-(pyridin-2-yldisulfanyl)propanamide |
|---|---|
| PubChem CID | 140672522 |
| Molecular Formula | C20H22N4O6S2 |
| Molecular Weight | 478.55 g/mol |
| Exact Mass | 478.10 |
| IUPAC Name | N-[3-[1-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-5-nitropyrrol-3-yl]prop-2-ynyl]-3-(pyridin-2-yldisulfanyl)propanamide |
| SMILES | O=C(CCSSc1ccccn1)NCC#Cc1cc([N+](=O)[O-])n([C@H]2C[C@H](O)[C@@H](CO)O2)c1 |
| InChI | InChI=1S/C20H22N4O6S2/c25-13-16-15(26)11-20(30-16)23-12-14(10-19(23)24(28)29)4-3-8-21-17(27)6-9-31-32-18-5-1-2-7-22-18/h1-2,5,7,10,12,15-16,20,25-26H,6,8-9,11,13H2,(H,21,27)/t15-,16+,20+/m0/s1 |
| InChIKey | ZUKWKZWOIMLPLR-RZQQEMMASA-N |
| XLogP | 1.73 |
| TPSA | 139.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.55 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|