About 4-(4-ethenylphenoxy)-2,6-bis(trifluoromethyl)benzenesulfonate
4-(4-ethenylphenoxy)-2,6-bis(trifluoromethyl)benzenesulfonate (PubChem CID 140673049) has the molecular formula C16H9F6O4S-
and a molecular weight of 411.30 g/mol. Its IUPAC name is 4-(4-ethenylphenoxy)-2,6-bis(trifluoromethyl)benzenesulfonate.
Molecular Properties
| Compound Name | 4-(4-ethenylphenoxy)-2,6-bis(trifluoromethyl)benzenesulfonate |
| PubChem CID | 140673049 |
| Molecular Formula | C16H9F6O4S- |
| Molecular Weight | 411.30 g/mol |
| Exact Mass | 411.01 |
| IUPAC Name | 4-(4-ethenylphenoxy)-2,6-bis(trifluoromethyl)benzenesulfonate |
| SMILES | C=Cc1ccc(Oc2cc(C(F)(F)F)c(S(=O)(=O)[O-])c(C(F)(F)F)c2)cc1 |
| InChI | InChI=1S/C16H10F6O4S/c1-2-9-3-5-10(6-4-9)26-11-7-12(15(17,18)19)14(27(23,24)25)13(8-11)16(20,21)22/h2-8H,1H2,(H,23,24,25)/p-1 |
| InChIKey | HINKODNCVUJVCS-UHFFFAOYSA-M |
| XLogP | 5.06 |
| TPSA | 66.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 411.30 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze 4-(4-ethenylphenoxy)-2,6-bis(trifluoromethyl)benzenesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(4-ethenylphenoxy)-2,6-bis(trifluoromethyl)benzenesulfonate?
The IUPAC name of 4-(4-ethenylphenoxy)-2,6-bis(trifluoromethyl)benzenesulfonate (CID 140673049) is 4-(4-ethenylphenoxy)-2,6-bis(trifluoromethyl)benzenesulfonate.
What is the SMILES notation for 4-(4-ethenylphenoxy)-2,6-bis(trifluoromethyl)benzenesulfonate?
The canonical SMILES for 4-(4-ethenylphenoxy)-2,6-bis(trifluoromethyl)benzenesulfonate is C=Cc1ccc(Oc2cc(C(F)(F)F)c(S(=O)(=O)[O-])c(C(F)(F)F)c2)cc1.
What is the InChIKey of 4-(4-ethenylphenoxy)-2,6-bis(trifluoromethyl)benzenesulfonate?
The InChIKey is HINKODNCVUJVCS-UHFFFAOYSA-M. The full InChI is InChI=1S/C16H10F6O4S/c1-2-9-3-5-10(6-4-9)26-11-7-12(15(17,18)19)14(27(23,24)25)13(8-11)16(20,21)22/h2-8H,1H2,(H,23,24,25)/p-1.
What are the key properties of 4-(4-ethenylphenoxy)-2,6-bis(trifluoromethyl)benzenesulfonate?
4-(4-ethenylphenoxy)-2,6-bis(trifluoromethyl)benzenesulfonate has a molecular weight of 411.30 g/mol, XLogP of 5.06, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(4-ethenylphenoxy)-2,6-bis(trifluoromethyl)benzenesulfonate is sourced from PubChem (CID 140673049), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).