C34H47BrO5Si — CID 140673260
5-bromo-3-[(3S)-3-[tert-butyl(dimethyl)silyl]oxyoctyl]-4,9a-dihydroxy-8-phenylmethoxy-4,9-dihydro-1H-cyclopenta[b]naphthalen-2-one (PubChem CID 140673260) has the molecular formula C34H47BrO5Si and a molecular weight of 643.74 g/mol. Its IUPAC name is 5-bromo-3-[(3S)-3-[tert-butyl(dimethyl)silyl]oxyoctyl]-4,9a-dihydroxy-8-phenylmethoxy-4,9-dihydro-1H-cyclopenta[b]naphthalen-2-one.
| Compound Name | 5-bromo-3-[(3S)-3-[tert-butyl(dimethyl)silyl]oxyoctyl]-4,9a-dihydroxy-8-phenylmethoxy-4,9-dihydro-1H-cyclopenta[b]naphthalen-2-one |
|---|---|
| PubChem CID | 140673260 |
| Molecular Formula | C34H47BrO5Si |
| Molecular Weight | 643.74 g/mol |
| Exact Mass | 642.24 |
| IUPAC Name | 5-bromo-3-[(3S)-3-[tert-butyl(dimethyl)silyl]oxyoctyl]-4,9a-dihydroxy-8-phenylmethoxy-4,9-dihydro-1H-cyclopenta[b]naphthalen-2-one |
| SMILES | CCCCC[C@@H](CCC1=C2C(O)c3c(Br)ccc(OCc4ccccc4)c3CC2(O)CC1=O)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C34H47BrO5Si/c1-7-8-10-15-24(40-41(5,6)33(2,3)4)16-17-25-28(36)21-34(38)20-26-29(39-22-23-13-11-9-12-14-23)19-18-27(35)30(26)32(37)31(25)34/h9,11-14,18-19,24,32,37-38H,7-8,10,15-17,20-22H2,1-6H3/t24-,32?,34?/m0/s1 |
| InChIKey | CBFZIBWBDMOFTB-RGDDMHCFSA-N |
| XLogP | 8.37 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 643.74 |
| LogP ≤ 5 | 8.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|