C27H44 — CID 140674000
1-(1-cyclopentyl-3-methyl-2-propan-2-ylbutyl)-3-pent-4-enyl-2,3,3a,7a-tetrahydro-1H-indene (PubChem CID 140674000) has the molecular formula C27H44 and a molecular weight of 368.65 g/mol. Its IUPAC name is 1-(1-cyclopentyl-3-methyl-2-propan-2-ylbutyl)-3-pent-4-enyl-2,3,3a,7a-tetrahydro-1H-indene.
| Compound Name | 1-(1-cyclopentyl-3-methyl-2-propan-2-ylbutyl)-3-pent-4-enyl-2,3,3a,7a-tetrahydro-1H-indene |
|---|---|
| PubChem CID | 140674000 |
| Molecular Formula | C27H44 |
| Molecular Weight | 368.65 g/mol |
| Exact Mass | 368.34 |
| IUPAC Name | 1-(1-cyclopentyl-3-methyl-2-propan-2-ylbutyl)-3-pent-4-enyl-2,3,3a,7a-tetrahydro-1H-indene |
| SMILES | C=CCCCC1CC(C(C2CCCC2)C(C(C)C)C(C)C)C2C=CC=CC12 |
| InChI | InChI=1S/C27H44/c1-6-7-8-15-22-18-25(24-17-12-11-16-23(22)24)27(21-13-9-10-14-21)26(19(2)3)20(4)5/h6,11-12,16-17,19-27H,1,7-10,13-15,18H2,2-5H3 |
| InChIKey | XKOUXHDXDCHFAB-UHFFFAOYSA-N |
| XLogP | 8.07 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.65 |
| LogP ≤ 5 | 8.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|