About 3,4-dimethyl-2-phenylsulfanyl-2H-furan-5-one;yttrium
3,4-dimethyl-2-phenylsulfanyl-2H-furan-5-one;yttrium (PubChem CID 140674093) has the molecular formula C12H11O2SY-
and a molecular weight of 308.19 g/mol. Its IUPAC name is 3,4-dimethyl-2-phenylsulfanyl-2H-furan-5-one;yttrium.
Molecular Properties
| Compound Name | 3,4-dimethyl-2-phenylsulfanyl-2H-furan-5-one;yttrium |
| PubChem CID | 140674093 |
| Molecular Formula | C12H11O2SY- |
| Molecular Weight | 308.19 g/mol |
| Exact Mass | 307.95 |
| IUPAC Name | 3,4-dimethyl-2-phenylsulfanyl-2H-furan-5-one;yttrium |
| SMILES | CC1=C(C)C(Sc2cc[c-]cc2)OC1=O.[Y] |
| InChI | InChI=1S/C12H11O2S.Y/c1-8-9(2)12(14-11(8)13)15-10-6-4-3-5-7-10;/h4-7,12H,1-2H3;/q-1; |
| InChIKey | FDTFWEPHCRKXCV-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 308.19 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze 3,4-dimethyl-2-phenylsulfanyl-2H-furan-5-one;yttrium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,4-dimethyl-2-phenylsulfanyl-2H-furan-5-one;yttrium?
The IUPAC name of 3,4-dimethyl-2-phenylsulfanyl-2H-furan-5-one;yttrium (CID 140674093) is 3,4-dimethyl-2-phenylsulfanyl-2H-furan-5-one;yttrium.
What is the SMILES notation for 3,4-dimethyl-2-phenylsulfanyl-2H-furan-5-one;yttrium?
The canonical SMILES for 3,4-dimethyl-2-phenylsulfanyl-2H-furan-5-one;yttrium is CC1=C(C)C(Sc2cc[c-]cc2)OC1=O.[Y].
What is the InChIKey of 3,4-dimethyl-2-phenylsulfanyl-2H-furan-5-one;yttrium?
The InChIKey is FDTFWEPHCRKXCV-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H11O2S.Y/c1-8-9(2)12(14-11(8)13)15-10-6-4-3-5-7-10;/h4-7,12H,1-2H3;/q-1;.
What are the key properties of 3,4-dimethyl-2-phenylsulfanyl-2H-furan-5-one;yttrium?
3,4-dimethyl-2-phenylsulfanyl-2H-furan-5-one;yttrium has a molecular weight of 308.19 g/mol, XLogP of 2.80, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3,4-dimethyl-2-phenylsulfanyl-2H-furan-5-one;yttrium is sourced from PubChem (CID 140674093), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).