7-nitroimidazo[1,2-a]quinoline-2-carboxylic acid

C12H7N3O4 — CID 14067489

IUPAC7-nitroimidazo[1,2-a]quinoline-2-carboxylic acid
SMILESO=C(O)c1cn2c(ccc3cc([N+](=O)[O-])ccc32)n1
InChIInChI=1S/C12H7N3O4/c16-12(17)9-6-14-10-3-2-8(15(18)19)5-7(10)1-4-11(14)13-9/h1-6H,(H,16,17)
InChIKeyAVHOUIWGRRNHPG-UHFFFAOYSA-N
MW257.21 g/mol
LogP2.09
Rot. Bonds2

About 7-nitroimidazo[1,2-a]quinoline-2-carboxylic acid

7-nitroimidazo[1,2-a]quinoline-2-carboxylic acid (PubChem CID 14067489) has the molecular formula C12H7N3O4 and a molecular weight of 257.21 g/mol. Its IUPAC name is 7-nitroimidazo[1,2-a]quinoline-2-carboxylic acid.

Molecular Properties

Compound Name7-nitroimidazo[1,2-a]quinoline-2-carboxylic acid
PubChem CID14067489
Molecular FormulaC12H7N3O4
Molecular Weight257.21 g/mol
Exact Mass257.04
IUPAC Name7-nitroimidazo[1,2-a]quinoline-2-carboxylic acid
SMILESO=C(O)c1cn2c(ccc3cc([N+](=O)[O-])ccc32)n1
InChIInChI=1S/C12H7N3O4/c16-12(17)9-6-14-10-3-2-8(15(18)19)5-7(10)1-4-11(14)13-9/h1-6H,(H,16,17)
InChIKeyAVHOUIWGRRNHPG-UHFFFAOYSA-N
XLogP2.09
TPSA97.74 Ų
H-Bond Donors1
H-Bond Acceptors5
Rotatable Bonds2
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500257.21
LogP ≤ 52.09
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 105

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}

Analyze 7-nitroimidazo[1,2-a]quinoline-2-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 7-nitroimidazo[1,2-a]quinoline-2-carboxylic acid?
The IUPAC name of 7-nitroimidazo[1,2-a]quinoline-2-carboxylic acid (CID 14067489) is 7-nitroimidazo[1,2-a]quinoline-2-carboxylic acid.
What is the SMILES notation for 7-nitroimidazo[1,2-a]quinoline-2-carboxylic acid?
The canonical SMILES for 7-nitroimidazo[1,2-a]quinoline-2-carboxylic acid is O=C(O)c1cn2c(ccc3cc([N+](=O)[O-])ccc32)n1.
What is the InChIKey of 7-nitroimidazo[1,2-a]quinoline-2-carboxylic acid?
The InChIKey is AVHOUIWGRRNHPG-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H7N3O4/c16-12(17)9-6-14-10-3-2-8(15(18)19)5-7(10)1-4-11(14)13-9/h1-6H,(H,16,17).
What are the key properties of 7-nitroimidazo[1,2-a]quinoline-2-carboxylic acid?
7-nitroimidazo[1,2-a]quinoline-2-carboxylic acid has a molecular weight of 257.21 g/mol, XLogP of 2.09, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 7-nitroimidazo[1,2-a]quinoline-2-carboxylic acid is sourced from PubChem (CID 14067489), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).