C12H7N3O4 — CID 14067489
7-nitroimidazo[1,2-a]quinoline-2-carboxylic acid (PubChem CID 14067489) has the molecular formula C12H7N3O4 and a molecular weight of 257.21 g/mol. Its IUPAC name is 7-nitroimidazo[1,2-a]quinoline-2-carboxylic acid.
| Compound Name | 7-nitroimidazo[1,2-a]quinoline-2-carboxylic acid |
|---|---|
| PubChem CID | 14067489 |
| Molecular Formula | C12H7N3O4 |
| Molecular Weight | 257.21 g/mol |
| Exact Mass | 257.04 |
| IUPAC Name | 7-nitroimidazo[1,2-a]quinoline-2-carboxylic acid |
| SMILES | O=C(O)c1cn2c(ccc3cc([N+](=O)[O-])ccc32)n1 |
| InChI | InChI=1S/C12H7N3O4/c16-12(17)9-6-14-10-3-2-8(15(18)19)5-7(10)1-4-11(14)13-9/h1-6H,(H,16,17) |
| InChIKey | AVHOUIWGRRNHPG-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 97.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.21 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|