About 1-oxobutan-2-yl carbamate
1-oxobutan-2-yl carbamate (PubChem CID 140674979) has the molecular formula C5H9NO3
and a molecular weight of 131.13 g/mol. Its IUPAC name is 1-oxobutan-2-yl carbamate.
Molecular Properties
| Compound Name | 1-oxobutan-2-yl carbamate |
| PubChem CID | 140674979 |
| Molecular Formula | C5H9NO3 |
| Molecular Weight | 131.13 g/mol |
| Exact Mass | 131.06 |
| IUPAC Name | 1-oxobutan-2-yl carbamate |
| SMILES | CCC(C=O)OC(N)=O |
| InChI | InChI=1S/C5H9NO3/c1-2-4(3-7)9-5(6)8/h3-4H,2H2,1H3,(H2,6,8) |
| InChIKey | CWLYDNBVLHRKOD-UHFFFAOYSA-N |
| XLogP | 0.06 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 131.13 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 1-oxobutan-2-yl carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-oxobutan-2-yl carbamate?
The IUPAC name of 1-oxobutan-2-yl carbamate (CID 140674979) is 1-oxobutan-2-yl carbamate.
What is the SMILES notation for 1-oxobutan-2-yl carbamate?
The canonical SMILES for 1-oxobutan-2-yl carbamate is CCC(C=O)OC(N)=O.
What is the InChIKey of 1-oxobutan-2-yl carbamate?
The InChIKey is CWLYDNBVLHRKOD-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H9NO3/c1-2-4(3-7)9-5(6)8/h3-4H,2H2,1H3,(H2,6,8).
What are the key properties of 1-oxobutan-2-yl carbamate?
1-oxobutan-2-yl carbamate has a molecular weight of 131.13 g/mol, XLogP of 0.06, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-oxobutan-2-yl carbamate is sourced from PubChem (CID 140674979), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).