C20H20F2N5O3S- — CID 140675013
(3Z)-N-(dimethylsulfamoyl)-4-fluoro-5-[(2R)-2-(3-fluorophenyl)pyrrolidin-1-yl]pyrazolo[1,5-a]pyridine-3-carboximidate (PubChem CID 140675013) has the molecular formula C20H20F2N5O3S- and a molecular weight of 448.48 g/mol. Its IUPAC name is (3Z)-N-(dimethylsulfamoyl)-4-fluoro-5-[(2R)-2-(3-fluorophenyl)pyrrolidin-1-yl]pyrazolo[1,5-a]pyridine-3-carboximidate.
| Compound Name | (3Z)-N-(dimethylsulfamoyl)-4-fluoro-5-[(2R)-2-(3-fluorophenyl)pyrrolidin-1-yl]pyrazolo[1,5-a]pyridine-3-carboximidate |
|---|---|
| PubChem CID | 140675013 |
| Molecular Formula | C20H20F2N5O3S- |
| Molecular Weight | 448.48 g/mol |
| Exact Mass | 448.13 |
| IUPAC Name | (3Z)-N-(dimethylsulfamoyl)-4-fluoro-5-[(2R)-2-(3-fluorophenyl)pyrrolidin-1-yl]pyrazolo[1,5-a]pyridine-3-carboximidate |
| SMILES | CN(C)S(=O)(=O)/N=C(\[O-])c1cnn2ccc(N3CCC[C@@H]3c3cccc(F)c3)c(F)c12 |
| InChI | InChI=1S/C20H21F2N5O3S/c1-25(2)31(29,30)24-20(28)15-12-23-27-10-8-17(18(22)19(15)27)26-9-4-7-16(26)13-5-3-6-14(21)11-13/h3,5-6,8,10-12,16H,4,7,9H2,1-2H3,(H,24,28)/p-1/t16-/m1/s1 |
| InChIKey | XHBGVBGCFJOSDD-MRXNPFEDSA-M |
| XLogP | 1.87 |
| TPSA | 93.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.48 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|