C22H40O4 — CID 140675206
1-[(2S,4R,5S)-6-ethyl-5-[(2S,4S,5S)-6-ethyl-3,4,5-trimethyloxan-2-yl]oxy-2,4-dimethyloxan-3-yl]propan-2-one (PubChem CID 140675206) has the molecular formula C22H40O4 and a molecular weight of 368.56 g/mol. Its IUPAC name is 1-[(2S,4R,5S)-6-ethyl-5-[(2S,4S,5S)-6-ethyl-3,4,5-trimethyloxan-2-yl]oxy-2,4-dimethyloxan-3-yl]propan-2-one.
| Compound Name | 1-[(2S,4R,5S)-6-ethyl-5-[(2S,4S,5S)-6-ethyl-3,4,5-trimethyloxan-2-yl]oxy-2,4-dimethyloxan-3-yl]propan-2-one |
|---|---|
| PubChem CID | 140675206 |
| Molecular Formula | C22H40O4 |
| Molecular Weight | 368.56 g/mol |
| Exact Mass | 368.29 |
| IUPAC Name | 1-[(2S,4R,5S)-6-ethyl-5-[(2S,4S,5S)-6-ethyl-3,4,5-trimethyloxan-2-yl]oxy-2,4-dimethyloxan-3-yl]propan-2-one |
| SMILES | CCC1O[C@@H](O[C@@H]2C(CC)O[C@@H](C)C(CC(C)=O)[C@H]2C)C(C)[C@@H](C)[C@@H]1C |
| InChI | InChI=1S/C22H40O4/c1-9-19-14(5)13(4)15(6)22(25-19)26-21-16(7)18(11-12(3)23)17(8)24-20(21)10-2/h13-22H,9-11H2,1-8H3/t13-,14-,15?,16+,17-,18?,19?,20?,21-,22-/m0/s1 |
| InChIKey | MIRGOUACUILKTG-HVSBXCATSA-N |
| XLogP | 4.84 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.56 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |