C20H21F3N6O2 — CID 140675887
N-pyridin-2-yl-5-[2-(trifluoromethyl)morpholin-4-yl]-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-8-carboxamide (PubChem CID 140675887) has the molecular formula C20H21F3N6O2 and a molecular weight of 434.42 g/mol. Its IUPAC name is N-pyridin-2-yl-5-[2-(trifluoromethyl)morpholin-4-yl]-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-8-carboxamide.
| Compound Name | N-pyridin-2-yl-5-[2-(trifluoromethyl)morpholin-4-yl]-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-8-carboxamide |
|---|---|
| PubChem CID | 140675887 |
| Molecular Formula | C20H21F3N6O2 |
| Molecular Weight | 434.42 g/mol |
| Exact Mass | 434.17 |
| IUPAC Name | N-pyridin-2-yl-5-[2-(trifluoromethyl)morpholin-4-yl]-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-8-carboxamide |
| SMILES | O=C(Nc1ccccn1)N1c2nc(N3CCOC(C(F)(F)F)C3)ccc2N2CCC1C2 |
| InChI | InChI=1S/C20H21F3N6O2/c21-20(22,23)15-12-28(9-10-31-15)17-5-4-14-18(26-17)29(13-6-8-27(14)11-13)19(30)25-16-3-1-2-7-24-16/h1-5,7,13,15H,6,8-12H2,(H,24,25,30) |
| InChIKey | XSEMIKWNHSLQBT-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 73.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.42 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |