C21H23F3N6O — CID 140675903
N-pyridin-2-yl-5-[(3R)-3-(trifluoromethyl)piperidin-1-yl]-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-8-carboxamide (PubChem CID 140675903) has the molecular formula C21H23F3N6O and a molecular weight of 432.45 g/mol. Its IUPAC name is N-pyridin-2-yl-5-[(3R)-3-(trifluoromethyl)piperidin-1-yl]-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-8-carboxamide.
| Compound Name | N-pyridin-2-yl-5-[(3R)-3-(trifluoromethyl)piperidin-1-yl]-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-8-carboxamide |
|---|---|
| PubChem CID | 140675903 |
| Molecular Formula | C21H23F3N6O |
| Molecular Weight | 432.45 g/mol |
| Exact Mass | 432.19 |
| IUPAC Name | N-pyridin-2-yl-5-[(3R)-3-(trifluoromethyl)piperidin-1-yl]-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-8-carboxamide |
| SMILES | O=C(Nc1ccccn1)N1c2nc(N3CCC[C@@H](C(F)(F)F)C3)ccc2N2CCC1C2 |
| InChI | InChI=1S/C21H23F3N6O/c22-21(23,24)14-4-3-10-29(12-14)18-7-6-16-19(27-18)30(15-8-11-28(16)13-15)20(31)26-17-5-1-2-9-25-17/h1-2,5-7,9,14-15H,3-4,8,10-13H2,(H,25,26,31)/t14-,15?/m1/s1 |
| InChIKey | KXKJKAMKZMZVIH-GICMACPYSA-N |
| XLogP | 3.89 |
| TPSA | 64.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.45 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |