About 8-methoxyimidazo[2,1-b][1,3]benzothiazole-2-carboxylic acid
8-methoxyimidazo[2,1-b][1,3]benzothiazole-2-carboxylic acid (PubChem CID 14067618) has the molecular formula C11H8N2O3S
and a molecular weight of 248.26 g/mol. Its IUPAC name is 8-methoxyimidazo[2,1-b][1,3]benzothiazole-2-carboxylic acid.
Molecular Properties
| Compound Name | 8-methoxyimidazo[2,1-b][1,3]benzothiazole-2-carboxylic acid |
| PubChem CID | 14067618 |
| Molecular Formula | C11H8N2O3S |
| Molecular Weight | 248.26 g/mol |
| Exact Mass | 248.03 |
| IUPAC Name | 8-methoxyimidazo[2,1-b][1,3]benzothiazole-2-carboxylic acid |
| SMILES | COc1cccc2sc3nc(C(=O)O)cn3c12 |
| InChI | InChI=1S/C11H8N2O3S/c1-16-7-3-2-4-8-9(7)13-5-6(10(14)15)12-11(13)17-8/h2-5H,1H3,(H,14,15) |
| InChIKey | VRFYGWXULGHBOE-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 248.26 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 8-methoxyimidazo[2,1-b][1,3]benzothiazole-2-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-methoxyimidazo[2,1-b][1,3]benzothiazole-2-carboxylic acid?
The IUPAC name of 8-methoxyimidazo[2,1-b][1,3]benzothiazole-2-carboxylic acid (CID 14067618) is 8-methoxyimidazo[2,1-b][1,3]benzothiazole-2-carboxylic acid.
What is the SMILES notation for 8-methoxyimidazo[2,1-b][1,3]benzothiazole-2-carboxylic acid?
The canonical SMILES for 8-methoxyimidazo[2,1-b][1,3]benzothiazole-2-carboxylic acid is COc1cccc2sc3nc(C(=O)O)cn3c12.
What is the InChIKey of 8-methoxyimidazo[2,1-b][1,3]benzothiazole-2-carboxylic acid?
The InChIKey is VRFYGWXULGHBOE-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H8N2O3S/c1-16-7-3-2-4-8-9(7)13-5-6(10(14)15)12-11(13)17-8/h2-5H,1H3,(H,14,15).
What are the key properties of 8-methoxyimidazo[2,1-b][1,3]benzothiazole-2-carboxylic acid?
8-methoxyimidazo[2,1-b][1,3]benzothiazole-2-carboxylic acid has a molecular weight of 248.26 g/mol, XLogP of 2.26, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 8-methoxyimidazo[2,1-b][1,3]benzothiazole-2-carboxylic acid is sourced from PubChem (CID 14067618), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).