About imidazo[2,1-b][1,3]benzothiazol-2-yl(phenyl)methanone
imidazo[2,1-b][1,3]benzothiazol-2-yl(phenyl)methanone (PubChem CID 14067627) has the molecular formula C16H10N2OS
and a molecular weight of 278.34 g/mol. Its IUPAC name is imidazo[2,1-b][1,3]benzothiazol-2-yl(phenyl)methanone.
Molecular Properties
| Compound Name | imidazo[2,1-b][1,3]benzothiazol-2-yl(phenyl)methanone |
| PubChem CID | 14067627 |
| Molecular Formula | C16H10N2OS |
| Molecular Weight | 278.34 g/mol |
| Exact Mass | 278.05 |
| IUPAC Name | imidazo[2,1-b][1,3]benzothiazol-2-yl(phenyl)methanone |
| SMILES | O=C(c1ccccc1)c1cn2c(n1)sc1ccccc12 |
| InChI | InChI=1S/C16H10N2OS/c19-15(11-6-2-1-3-7-11)12-10-18-13-8-4-5-9-14(13)20-16(18)17-12/h1-10H |
| InChIKey | HVDWMNFEQUCYPY-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 34.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.34 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze imidazo[2,1-b][1,3]benzothiazol-2-yl(phenyl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of imidazo[2,1-b][1,3]benzothiazol-2-yl(phenyl)methanone?
The IUPAC name of imidazo[2,1-b][1,3]benzothiazol-2-yl(phenyl)methanone (CID 14067627) is imidazo[2,1-b][1,3]benzothiazol-2-yl(phenyl)methanone.
What is the SMILES notation for imidazo[2,1-b][1,3]benzothiazol-2-yl(phenyl)methanone?
The canonical SMILES for imidazo[2,1-b][1,3]benzothiazol-2-yl(phenyl)methanone is O=C(c1ccccc1)c1cn2c(n1)sc1ccccc12.
What is the InChIKey of imidazo[2,1-b][1,3]benzothiazol-2-yl(phenyl)methanone?
The InChIKey is HVDWMNFEQUCYPY-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H10N2OS/c19-15(11-6-2-1-3-7-11)12-10-18-13-8-4-5-9-14(13)20-16(18)17-12/h1-10H.
What are the key properties of imidazo[2,1-b][1,3]benzothiazol-2-yl(phenyl)methanone?
imidazo[2,1-b][1,3]benzothiazol-2-yl(phenyl)methanone has a molecular weight of 278.34 g/mol, XLogP of 3.78, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for imidazo[2,1-b][1,3]benzothiazol-2-yl(phenyl)methanone is sourced from PubChem (CID 14067627), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).