About (6-ethylimidazo[2,1-b][1,3]benzothiazol-2-yl)-phenylmethanone
(6-ethylimidazo[2,1-b][1,3]benzothiazol-2-yl)-phenylmethanone (PubChem CID 14067628) has the molecular formula C18H14N2OS
and a molecular weight of 306.39 g/mol. Its IUPAC name is (6-ethylimidazo[2,1-b][1,3]benzothiazol-2-yl)-phenylmethanone.
Molecular Properties
| Compound Name | (6-ethylimidazo[2,1-b][1,3]benzothiazol-2-yl)-phenylmethanone |
| PubChem CID | 14067628 |
| Molecular Formula | C18H14N2OS |
| Molecular Weight | 306.39 g/mol |
| Exact Mass | 306.08 |
| IUPAC Name | (6-ethylimidazo[2,1-b][1,3]benzothiazol-2-yl)-phenylmethanone |
| SMILES | CCc1ccc2c(c1)sc1nc(C(=O)c3ccccc3)cn12 |
| InChI | InChI=1S/C18H14N2OS/c1-2-12-8-9-15-16(10-12)22-18-19-14(11-20(15)18)17(21)13-6-4-3-5-7-13/h3-11H,2H2,1H3 |
| InChIKey | VOMUIZAFFXJSDB-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 34.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 306.39 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (6-ethylimidazo[2,1-b][1,3]benzothiazol-2-yl)-phenylmethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6-ethylimidazo[2,1-b][1,3]benzothiazol-2-yl)-phenylmethanone?
The IUPAC name of (6-ethylimidazo[2,1-b][1,3]benzothiazol-2-yl)-phenylmethanone (CID 14067628) is (6-ethylimidazo[2,1-b][1,3]benzothiazol-2-yl)-phenylmethanone.
What is the SMILES notation for (6-ethylimidazo[2,1-b][1,3]benzothiazol-2-yl)-phenylmethanone?
The canonical SMILES for (6-ethylimidazo[2,1-b][1,3]benzothiazol-2-yl)-phenylmethanone is CCc1ccc2c(c1)sc1nc(C(=O)c3ccccc3)cn12.
What is the InChIKey of (6-ethylimidazo[2,1-b][1,3]benzothiazol-2-yl)-phenylmethanone?
The InChIKey is VOMUIZAFFXJSDB-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H14N2OS/c1-2-12-8-9-15-16(10-12)22-18-19-14(11-20(15)18)17(21)13-6-4-3-5-7-13/h3-11H,2H2,1H3.
What are the key properties of (6-ethylimidazo[2,1-b][1,3]benzothiazol-2-yl)-phenylmethanone?
(6-ethylimidazo[2,1-b][1,3]benzothiazol-2-yl)-phenylmethanone has a molecular weight of 306.39 g/mol, XLogP of 4.34, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (6-ethylimidazo[2,1-b][1,3]benzothiazol-2-yl)-phenylmethanone is sourced from PubChem (CID 14067628), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).