About propyl imidazo[2,1-b][1,3]benzothiazole-2-carboxylate
propyl imidazo[2,1-b][1,3]benzothiazole-2-carboxylate (PubChem CID 14067630) has the molecular formula C13H12N2O2S
and a molecular weight of 260.32 g/mol. Its IUPAC name is propyl imidazo[2,1-b][1,3]benzothiazole-2-carboxylate.
Molecular Properties
| Compound Name | propyl imidazo[2,1-b][1,3]benzothiazole-2-carboxylate |
| PubChem CID | 14067630 |
| Molecular Formula | C13H12N2O2S |
| Molecular Weight | 260.32 g/mol |
| Exact Mass | 260.06 |
| IUPAC Name | propyl imidazo[2,1-b][1,3]benzothiazole-2-carboxylate |
| SMILES | CCCOC(=O)c1cn2c(n1)sc1ccccc12 |
| InChI | InChI=1S/C13H12N2O2S/c1-2-7-17-12(16)9-8-15-10-5-3-4-6-11(10)18-13(15)14-9/h3-6,8H,2,7H2,1H3 |
| InChIKey | XQAKERFJMNECIA-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.32 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze propyl imidazo[2,1-b][1,3]benzothiazole-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propyl imidazo[2,1-b][1,3]benzothiazole-2-carboxylate?
The IUPAC name of propyl imidazo[2,1-b][1,3]benzothiazole-2-carboxylate (CID 14067630) is propyl imidazo[2,1-b][1,3]benzothiazole-2-carboxylate.
What is the SMILES notation for propyl imidazo[2,1-b][1,3]benzothiazole-2-carboxylate?
The canonical SMILES for propyl imidazo[2,1-b][1,3]benzothiazole-2-carboxylate is CCCOC(=O)c1cn2c(n1)sc1ccccc12.
What is the InChIKey of propyl imidazo[2,1-b][1,3]benzothiazole-2-carboxylate?
The InChIKey is XQAKERFJMNECIA-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H12N2O2S/c1-2-7-17-12(16)9-8-15-10-5-3-4-6-11(10)18-13(15)14-9/h3-6,8H,2,7H2,1H3.
What are the key properties of propyl imidazo[2,1-b][1,3]benzothiazole-2-carboxylate?
propyl imidazo[2,1-b][1,3]benzothiazole-2-carboxylate has a molecular weight of 260.32 g/mol, XLogP of 3.12, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for propyl imidazo[2,1-b][1,3]benzothiazole-2-carboxylate is sourced from PubChem (CID 14067630), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).