About cyclohexyl imidazo[2,1-b][1,3]benzothiazole-2-carboxylate
cyclohexyl imidazo[2,1-b][1,3]benzothiazole-2-carboxylate (PubChem CID 14067632) has the molecular formula C16H16N2O2S
and a molecular weight of 300.38 g/mol. Its IUPAC name is cyclohexyl imidazo[2,1-b][1,3]benzothiazole-2-carboxylate.
Molecular Properties
| Compound Name | cyclohexyl imidazo[2,1-b][1,3]benzothiazole-2-carboxylate |
| PubChem CID | 14067632 |
| Molecular Formula | C16H16N2O2S |
| Molecular Weight | 300.38 g/mol |
| Exact Mass | 300.09 |
| IUPAC Name | cyclohexyl imidazo[2,1-b][1,3]benzothiazole-2-carboxylate |
| SMILES | O=C(OC1CCCCC1)c1cn2c(n1)sc1ccccc12 |
| InChI | InChI=1S/C16H16N2O2S/c19-15(20-11-6-2-1-3-7-11)12-10-18-13-8-4-5-9-14(13)21-16(18)17-12/h4-5,8-11H,1-3,6-7H2 |
| InChIKey | CFEASAXEGGMTSQ-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 300.38 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze cyclohexyl imidazo[2,1-b][1,3]benzothiazole-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclohexyl imidazo[2,1-b][1,3]benzothiazole-2-carboxylate?
The IUPAC name of cyclohexyl imidazo[2,1-b][1,3]benzothiazole-2-carboxylate (CID 14067632) is cyclohexyl imidazo[2,1-b][1,3]benzothiazole-2-carboxylate.
What is the SMILES notation for cyclohexyl imidazo[2,1-b][1,3]benzothiazole-2-carboxylate?
The canonical SMILES for cyclohexyl imidazo[2,1-b][1,3]benzothiazole-2-carboxylate is O=C(OC1CCCCC1)c1cn2c(n1)sc1ccccc12.
What is the InChIKey of cyclohexyl imidazo[2,1-b][1,3]benzothiazole-2-carboxylate?
The InChIKey is CFEASAXEGGMTSQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H16N2O2S/c19-15(20-11-6-2-1-3-7-11)12-10-18-13-8-4-5-9-14(13)21-16(18)17-12/h4-5,8-11H,1-3,6-7H2.
What are the key properties of cyclohexyl imidazo[2,1-b][1,3]benzothiazole-2-carboxylate?
cyclohexyl imidazo[2,1-b][1,3]benzothiazole-2-carboxylate has a molecular weight of 300.38 g/mol, XLogP of 4.04, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for cyclohexyl imidazo[2,1-b][1,3]benzothiazole-2-carboxylate is sourced from PubChem (CID 14067632), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).