C17H15N3OS2 — CID 14067659
(8-methylsulfanyl-11-thia-2,5,7-triazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7-tetraen-4-yl)-phenylmethanone (PubChem CID 14067659) has the molecular formula C17H15N3OS2 and a molecular weight of 341.46 g/mol. Its IUPAC name is (8-methylsulfanyl-11-thia-2,5,7-triazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7-tetraen-4-yl)-phenylmethanone.
| Compound Name | (8-methylsulfanyl-11-thia-2,5,7-triazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7-tetraen-4-yl)-phenylmethanone |
|---|---|
| PubChem CID | 14067659 |
| Molecular Formula | C17H15N3OS2 |
| Molecular Weight | 341.46 g/mol |
| Exact Mass | 341.07 |
| IUPAC Name | (8-methylsulfanyl-11-thia-2,5,7-triazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7-tetraen-4-yl)-phenylmethanone |
| SMILES | CSc1nc2nc(C(=O)c3ccccc3)cn2c2c1CSCC2 |
| InChI | InChI=1S/C17H15N3OS2/c1-22-16-12-10-23-8-7-14(12)20-9-13(18-17(20)19-16)15(21)11-5-3-2-4-6-11/h2-6,9H,7-8,10H2,1H3 |
| InChIKey | QGTOYFDVJYEWSD-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 47.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.46 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |