C37H36IrN2-2 — CID 140677068
2-(1,1,2,2,3,3-hexamethyl-6H-inden-6-id-5-yl)-4-phenylpyridine;iridium;2-phenylpyridine (PubChem CID 140677068) has the molecular formula C37H36IrN2-2 and a molecular weight of 700.93 g/mol. Its IUPAC name is 2-(1,1,2,2,3,3-hexamethyl-6H-inden-6-id-5-yl)-4-phenylpyridine;iridium;2-phenylpyridine.
| Compound Name | 2-(1,1,2,2,3,3-hexamethyl-6H-inden-6-id-5-yl)-4-phenylpyridine;iridium;2-phenylpyridine |
|---|---|
| PubChem CID | 140677068 |
| Molecular Formula | C37H36IrN2-2 |
| Molecular Weight | 700.93 g/mol |
| Exact Mass | 701.25 |
| IUPAC Name | 2-(1,1,2,2,3,3-hexamethyl-6H-inden-6-id-5-yl)-4-phenylpyridine;iridium;2-phenylpyridine |
| SMILES | CC1(C)c2c[c-]c(-c3cc(-c4ccccc4)ccn3)cc2C(C)(C)C1(C)C.[Ir].[c-]1ccccc1-c1ccccn1 |
| InChI | InChI=1S/C26H28N.C11H8N.Ir/c1-24(2)21-13-12-20(16-22(21)25(3,4)26(24,5)6)23-17-19(14-15-27-23)18-10-8-7-9-11-18;1-2-6-10(7-3-1)11-8-4-5-9-12-11;/h7-11,13-17H,1-6H3;1-6,8-9H;/q2*-1; |
| InChIKey | FPQOVZMTPYRRED-UHFFFAOYSA-N |
| XLogP | 9.36 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 700.93 |
| LogP ≤ 5 | 9.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|