About 4-ethyl-6,7-dimethoxy-1-methyl-2H-isoquinolin-3-one
4-ethyl-6,7-dimethoxy-1-methyl-2H-isoquinolin-3-one (PubChem CID 14067808) has the molecular formula C14H17NO3
and a molecular weight of 247.29 g/mol. Its IUPAC name is 4-ethyl-6,7-dimethoxy-1-methyl-2H-isoquinolin-3-one.
Molecular Properties
| Compound Name | 4-ethyl-6,7-dimethoxy-1-methyl-2H-isoquinolin-3-one |
| PubChem CID | 14067808 |
| Molecular Formula | C14H17NO3 |
| Molecular Weight | 247.29 g/mol |
| Exact Mass | 247.12 |
| IUPAC Name | 4-ethyl-6,7-dimethoxy-1-methyl-2H-isoquinolin-3-one |
| SMILES | CCc1c(=O)[nH]c(C)c2cc(OC)c(OC)cc12 |
| InChI | InChI=1S/C14H17NO3/c1-5-9-11-7-13(18-4)12(17-3)6-10(11)8(2)15-14(9)16/h6-7H,5H2,1-4H3,(H,15,16) |
| InChIKey | OQYJVTPREWTTPY-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 51.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 247.29 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-ethyl-6,7-dimethoxy-1-methyl-2H-isoquinolin-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-ethyl-6,7-dimethoxy-1-methyl-2H-isoquinolin-3-one?
The IUPAC name of 4-ethyl-6,7-dimethoxy-1-methyl-2H-isoquinolin-3-one (CID 14067808) is 4-ethyl-6,7-dimethoxy-1-methyl-2H-isoquinolin-3-one.
What is the SMILES notation for 4-ethyl-6,7-dimethoxy-1-methyl-2H-isoquinolin-3-one?
The canonical SMILES for 4-ethyl-6,7-dimethoxy-1-methyl-2H-isoquinolin-3-one is CCc1c(=O)[nH]c(C)c2cc(OC)c(OC)cc12.
What is the InChIKey of 4-ethyl-6,7-dimethoxy-1-methyl-2H-isoquinolin-3-one?
The InChIKey is OQYJVTPREWTTPY-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H17NO3/c1-5-9-11-7-13(18-4)12(17-3)6-10(11)8(2)15-14(9)16/h6-7H,5H2,1-4H3,(H,15,16).
What are the key properties of 4-ethyl-6,7-dimethoxy-1-methyl-2H-isoquinolin-3-one?
4-ethyl-6,7-dimethoxy-1-methyl-2H-isoquinolin-3-one has a molecular weight of 247.29 g/mol, XLogP of 2.42, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-ethyl-6,7-dimethoxy-1-methyl-2H-isoquinolin-3-one is sourced from PubChem (CID 14067808), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).