About 6,7-dimethoxy-1,4-dimethyl-2H-isoquinolin-3-one
6,7-dimethoxy-1,4-dimethyl-2H-isoquinolin-3-one (PubChem CID 14067809) has the molecular formula C13H15NO3
and a molecular weight of 233.27 g/mol. Its IUPAC name is 6,7-dimethoxy-1,4-dimethyl-2H-isoquinolin-3-one.
Molecular Properties
| Compound Name | 6,7-dimethoxy-1,4-dimethyl-2H-isoquinolin-3-one |
| PubChem CID | 14067809 |
| Molecular Formula | C13H15NO3 |
| Molecular Weight | 233.27 g/mol |
| Exact Mass | 233.11 |
| IUPAC Name | 6,7-dimethoxy-1,4-dimethyl-2H-isoquinolin-3-one |
| SMILES | COc1cc2c(C)[nH]c(=O)c(C)c2cc1OC |
| InChI | InChI=1S/C13H15NO3/c1-7-9-5-11(16-3)12(17-4)6-10(9)8(2)14-13(7)15/h5-6H,1-4H3,(H,14,15) |
| InChIKey | GZOKWEHTOJFPDJ-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 51.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.27 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6,7-dimethoxy-1,4-dimethyl-2H-isoquinolin-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6,7-dimethoxy-1,4-dimethyl-2H-isoquinolin-3-one?
The IUPAC name of 6,7-dimethoxy-1,4-dimethyl-2H-isoquinolin-3-one (CID 14067809) is 6,7-dimethoxy-1,4-dimethyl-2H-isoquinolin-3-one.
What is the SMILES notation for 6,7-dimethoxy-1,4-dimethyl-2H-isoquinolin-3-one?
The canonical SMILES for 6,7-dimethoxy-1,4-dimethyl-2H-isoquinolin-3-one is COc1cc2c(C)[nH]c(=O)c(C)c2cc1OC.
What is the InChIKey of 6,7-dimethoxy-1,4-dimethyl-2H-isoquinolin-3-one?
The InChIKey is GZOKWEHTOJFPDJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H15NO3/c1-7-9-5-11(16-3)12(17-4)6-10(9)8(2)14-13(7)15/h5-6H,1-4H3,(H,14,15).
What are the key properties of 6,7-dimethoxy-1,4-dimethyl-2H-isoquinolin-3-one?
6,7-dimethoxy-1,4-dimethyl-2H-isoquinolin-3-one has a molecular weight of 233.27 g/mol, XLogP of 2.16, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6,7-dimethoxy-1,4-dimethyl-2H-isoquinolin-3-one is sourced from PubChem (CID 14067809), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).