C11H7F4NO — CID 140679028
7-fluoro-3-methyl-6-(trifluoromethyl)-2H-isoquinolin-1-one (PubChem CID 140679028) has the molecular formula C11H7F4NO and a molecular weight of 245.17 g/mol. Its IUPAC name is 7-fluoro-3-methyl-6-(trifluoromethyl)-2H-isoquinolin-1-one.
| Compound Name | 7-fluoro-3-methyl-6-(trifluoromethyl)-2H-isoquinolin-1-one |
|---|---|
| PubChem CID | 140679028 |
| Molecular Formula | C11H7F4NO |
| Molecular Weight | 245.17 g/mol |
| Exact Mass | 245.05 |
| IUPAC Name | 7-fluoro-3-methyl-6-(trifluoromethyl)-2H-isoquinolin-1-one |
| SMILES | Cc1cc2cc(C(F)(F)F)c(F)cc2c(=O)[nH]1 |
| InChI | InChI=1S/C11H7F4NO/c1-5-2-6-3-8(11(13,14)15)9(12)4-7(6)10(17)16-5/h2-4H,1H3,(H,16,17) |
| InChIKey | PIAMZSRSTYXDOV-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 32.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.17 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |