C13H13N5O2S — CID 140679096
1-phenyl-1-([1,2,4]triazolo[4,3-a]pyrazin-5-yl)ethanesulfonamide (PubChem CID 140679096) has the molecular formula C13H13N5O2S and a molecular weight of 303.35 g/mol. Its IUPAC name is 1-phenyl-1-([1,2,4]triazolo[4,3-a]pyrazin-5-yl)ethanesulfonamide.
| Compound Name | 1-phenyl-1-([1,2,4]triazolo[4,3-a]pyrazin-5-yl)ethanesulfonamide |
|---|---|
| PubChem CID | 140679096 |
| Molecular Formula | C13H13N5O2S |
| Molecular Weight | 303.35 g/mol |
| Exact Mass | 303.08 |
| IUPAC Name | 1-phenyl-1-([1,2,4]triazolo[4,3-a]pyrazin-5-yl)ethanesulfonamide |
| SMILES | CC(c1ccccc1)(c1cncc2nncn12)S(N)(=O)=O |
| InChI | InChI=1S/C13H13N5O2S/c1-13(21(14,19)20,10-5-3-2-4-6-10)11-7-15-8-12-17-16-9-18(11)12/h2-9H,1H3,(H2,14,19,20) |
| InChIKey | GFQCFGLFFJLLRP-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 103.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.35 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |