C16H20FNO4 — CID 140679266
benzyl (2R,3S,4S)-4-fluoro-2-(hydroxymethyl)-3-prop-2-enoxypyrrolidine-1-carboxylate (PubChem CID 140679266) has the molecular formula C16H20FNO4 and a molecular weight of 309.34 g/mol. Its IUPAC name is benzyl (2R,3S,4S)-4-fluoro-2-(hydroxymethyl)-3-prop-2-enoxypyrrolidine-1-carboxylate.
| Compound Name | benzyl (2R,3S,4S)-4-fluoro-2-(hydroxymethyl)-3-prop-2-enoxypyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 140679266 |
| Molecular Formula | C16H20FNO4 |
| Molecular Weight | 309.34 g/mol |
| Exact Mass | 309.14 |
| IUPAC Name | benzyl (2R,3S,4S)-4-fluoro-2-(hydroxymethyl)-3-prop-2-enoxypyrrolidine-1-carboxylate |
| SMILES | C=CCO[C@H]1[C@@H](CO)N(C(=O)OCc2ccccc2)C[C@@H]1F |
| InChI | InChI=1S/C16H20FNO4/c1-2-8-21-15-13(17)9-18(14(15)10-19)16(20)22-11-12-6-4-3-5-7-12/h2-7,13-15,19H,1,8-11H2/t13-,14+,15+/m0/s1 |
| InChIKey | ZGEQQRFJKHMREZ-RRFJBIMHSA-N |
| XLogP | 1.91 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.34 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|