C8H18 — CID 140679837
1,1,1,2,2-pentadeuterio-5,5-dimethylhexane (PubChem CID 140679837) has the molecular formula C8H18 and a molecular weight of 119.26 g/mol. Its IUPAC name is 1,1,1,2,2-pentadeuterio-5,5-dimethylhexane.
| Compound Name | 1,1,1,2,2-pentadeuterio-5,5-dimethylhexane |
|---|---|
| PubChem CID | 140679837 |
| Molecular Formula | C8H18 |
| Molecular Weight | 119.26 g/mol |
| Exact Mass | 119.17 |
| IUPAC Name | 1,1,1,2,2-pentadeuterio-5,5-dimethylhexane |
| SMILES | [2H]C([2H])([2H])C([2H])([2H])CCC(C)(C)C |
| InChI | InChI=1S/C8H18/c1-5-6-7-8(2,3)4/h5-7H2,1-4H3/i1D3,5D2 |
| InChIKey | FLTJDUOFAQWHDF-RPIBLTHZSA-N |
| XLogP | 3.22 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 119.26 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |