About 2,5-dimethyl-1,3-diphenylpyrrole
2,5-dimethyl-1,3-diphenylpyrrole (PubChem CID 14068042) has the molecular formula C18H17N
and a molecular weight of 247.34 g/mol. Its IUPAC name is 2,5-dimethyl-1,3-diphenylpyrrole.
Molecular Properties
| Compound Name | 2,5-dimethyl-1,3-diphenylpyrrole |
| PubChem CID | 14068042 |
| Molecular Formula | C18H17N |
| Molecular Weight | 247.34 g/mol |
| Exact Mass | 247.14 |
| IUPAC Name | 2,5-dimethyl-1,3-diphenylpyrrole |
| SMILES | Cc1cc(-c2ccccc2)c(C)n1-c1ccccc1 |
| InChI | InChI=1S/C18H17N/c1-14-13-18(16-9-5-3-6-10-16)15(2)19(14)17-11-7-4-8-12-17/h3-13H,1-2H3 |
| InChIKey | RKRDSADIVAXQAH-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 247.34 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|
Analyze 2,5-dimethyl-1,3-diphenylpyrrole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,5-dimethyl-1,3-diphenylpyrrole?
The IUPAC name of 2,5-dimethyl-1,3-diphenylpyrrole (CID 14068042) is 2,5-dimethyl-1,3-diphenylpyrrole.
What is the SMILES notation for 2,5-dimethyl-1,3-diphenylpyrrole?
The canonical SMILES for 2,5-dimethyl-1,3-diphenylpyrrole is Cc1cc(-c2ccccc2)c(C)n1-c1ccccc1.
What is the InChIKey of 2,5-dimethyl-1,3-diphenylpyrrole?
The InChIKey is RKRDSADIVAXQAH-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H17N/c1-14-13-18(16-9-5-3-6-10-16)15(2)19(14)17-11-7-4-8-12-17/h3-13H,1-2H3.
What are the key properties of 2,5-dimethyl-1,3-diphenylpyrrole?
2,5-dimethyl-1,3-diphenylpyrrole has a molecular weight of 247.34 g/mol, XLogP of 4.76, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,5-dimethyl-1,3-diphenylpyrrole is sourced from PubChem (CID 14068042), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).