C22H24BF3N2O3 — CID 140680531
3-[[2-(difluoromethoxy)phenyl]methyl]-7-fluoro-2-methyl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)imidazo[1,2-a]pyridine (PubChem CID 140680531) has the molecular formula C22H24BF3N2O3 and a molecular weight of 432.25 g/mol. Its IUPAC name is 3-[[2-(difluoromethoxy)phenyl]methyl]-7-fluoro-2-methyl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)imidazo[1,2-a]pyridine.
| Compound Name | 3-[[2-(difluoromethoxy)phenyl]methyl]-7-fluoro-2-methyl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)imidazo[1,2-a]pyridine |
|---|---|
| PubChem CID | 140680531 |
| Molecular Formula | C22H24BF3N2O3 |
| Molecular Weight | 432.25 g/mol |
| Exact Mass | 432.18 |
| IUPAC Name | 3-[[2-(difluoromethoxy)phenyl]methyl]-7-fluoro-2-methyl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)imidazo[1,2-a]pyridine |
| SMILES | Cc1nc2cc(F)c(B3OC(C)(C)C(C)(C)O3)cn2c1Cc1ccccc1OC(F)F |
| InChI | InChI=1S/C22H24BF3N2O3/c1-13-17(10-14-8-6-7-9-18(14)29-20(25)26)28-12-15(16(24)11-19(28)27-13)23-30-21(2,3)22(4,5)31-23/h6-9,11-12,20H,10H2,1-5H3 |
| InChIKey | BVTCNITVCDUZOW-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 44.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.25 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|