C33H21AsN4O2 — CID 140680742
9-[3-[(6-pyrido[2,3-b]indol-9-yl-2-pyridinyl)oxy]phenyl]arsindolo[2,3-b]pyridine 9-oxide (PubChem CID 140680742) has the molecular formula C33H21AsN4O2 and a molecular weight of 580.48 g/mol. Its IUPAC name is 9-[3-[(6-pyrido[2,3-b]indol-9-yl-2-pyridinyl)oxy]phenyl]arsindolo[2,3-b]pyridine 9-oxide.
| Compound Name | 9-[3-[(6-pyrido[2,3-b]indol-9-yl-2-pyridinyl)oxy]phenyl]arsindolo[2,3-b]pyridine 9-oxide |
|---|---|
| PubChem CID | 140680742 |
| Molecular Formula | C33H21AsN4O2 |
| Molecular Weight | 580.48 g/mol |
| Exact Mass | 580.09 |
| IUPAC Name | 9-[3-[(6-pyrido[2,3-b]indol-9-yl-2-pyridinyl)oxy]phenyl]arsindolo[2,3-b]pyridine 9-oxide |
| SMILES | O=[As]1(c2cccc(Oc3cccc(-n4c5ccccc5c5cccnc54)n3)c2)c2ccccc2-c2cccnc21 |
| InChI | InChI=1S/C33H21AsN4O2/c39-34(28-15-3-1-11-24(28)26-13-7-19-35-32(26)34)22-9-5-10-23(21-22)40-31-18-6-17-30(37-31)38-29-16-4-2-12-25(29)27-14-8-20-36-33(27)38/h1-21H |
| InChIKey | OLVZMZTVFKZOFN-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 69.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.48 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|