C33H35O5S+ — CID 140681164
[3,5-dimethyl-4-[2-[(2-methyl-5-oxo-4-oxatricyclo[4.3.1.13,8]undecan-2-yl)oxy]-2-oxoethoxy]phenyl]-diphenylsulfanium (PubChem CID 140681164) has the molecular formula C33H35O5S+ and a molecular weight of 543.71 g/mol. Its IUPAC name is [3,5-dimethyl-4-[2-[(2-methyl-5-oxo-4-oxatricyclo[4.3.1.13,8]undecan-2-yl)oxy]-2-oxoethoxy]phenyl]-diphenylsulfanium.
| Compound Name | [3,5-dimethyl-4-[2-[(2-methyl-5-oxo-4-oxatricyclo[4.3.1.13,8]undecan-2-yl)oxy]-2-oxoethoxy]phenyl]-diphenylsulfanium |
|---|---|
| PubChem CID | 140681164 |
| Molecular Formula | C33H35O5S+ |
| Molecular Weight | 543.71 g/mol |
| Exact Mass | 543.22 |
| IUPAC Name | [3,5-dimethyl-4-[2-[(2-methyl-5-oxo-4-oxatricyclo[4.3.1.13,8]undecan-2-yl)oxy]-2-oxoethoxy]phenyl]-diphenylsulfanium |
| SMILES | Cc1cc([S+](c2ccccc2)c2ccccc2)cc(C)c1OCC(=O)OC1(C)C2CC3CC(C2)C(=O)OC1C3 |
| InChI | InChI=1S/C33H35O5S/c1-21-14-28(39(26-10-6-4-7-11-26)27-12-8-5-9-13-27)15-22(2)31(21)36-20-30(34)38-33(3)25-17-23-16-24(19-25)32(35)37-29(33)18-23/h4-15,23-25,29H,16-20H2,1-3H3/q+1 |
| InChIKey | PXGODUSKWWFHNH-UHFFFAOYSA-N |
| XLogP | 6.44 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.71 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|