About 5,6-diphenyloxadiazolo[5,4-b]pyridine
5,6-diphenyloxadiazolo[5,4-b]pyridine (PubChem CID 140681171) has the molecular formula C17H11N3O
and a molecular weight of 273.30 g/mol. Its IUPAC name is 5,6-diphenyloxadiazolo[5,4-b]pyridine.
Molecular Properties
| Compound Name | 5,6-diphenyloxadiazolo[5,4-b]pyridine |
| PubChem CID | 140681171 |
| Molecular Formula | C17H11N3O |
| Molecular Weight | 273.30 g/mol |
| Exact Mass | 273.09 |
| IUPAC Name | 5,6-diphenyloxadiazolo[5,4-b]pyridine |
| SMILES | c1ccc(-c2cc3nnoc3nc2-c2ccccc2)cc1 |
| InChI | InChI=1S/C17H11N3O/c1-3-7-12(8-4-1)14-11-15-17(21-20-19-15)18-16(14)13-9-5-2-6-10-13/h1-11H |
| InChIKey | MFRQEYVFUXSMBU-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 51.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 273.30 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5,6-diphenyloxadiazolo[5,4-b]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,6-diphenyloxadiazolo[5,4-b]pyridine?
The IUPAC name of 5,6-diphenyloxadiazolo[5,4-b]pyridine (CID 140681171) is 5,6-diphenyloxadiazolo[5,4-b]pyridine.
What is the SMILES notation for 5,6-diphenyloxadiazolo[5,4-b]pyridine?
The canonical SMILES for 5,6-diphenyloxadiazolo[5,4-b]pyridine is c1ccc(-c2cc3nnoc3nc2-c2ccccc2)cc1.
What is the InChIKey of 5,6-diphenyloxadiazolo[5,4-b]pyridine?
The InChIKey is MFRQEYVFUXSMBU-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H11N3O/c1-3-7-12(8-4-1)14-11-15-17(21-20-19-15)18-16(14)13-9-5-2-6-10-13/h1-11H.
What are the key properties of 5,6-diphenyloxadiazolo[5,4-b]pyridine?
5,6-diphenyloxadiazolo[5,4-b]pyridine has a molecular weight of 273.30 g/mol, XLogP of 3.95, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5,6-diphenyloxadiazolo[5,4-b]pyridine is sourced from PubChem (CID 140681171), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).