About 6,7-dimethyl-5-phenyloxadiazolo[5,4-b]pyridine
6,7-dimethyl-5-phenyloxadiazolo[5,4-b]pyridine (PubChem CID 140681174) has the molecular formula C13H11N3O
and a molecular weight of 225.25 g/mol. Its IUPAC name is 6,7-dimethyl-5-phenyloxadiazolo[5,4-b]pyridine.
Molecular Properties
| Compound Name | 6,7-dimethyl-5-phenyloxadiazolo[5,4-b]pyridine |
| PubChem CID | 140681174 |
| Molecular Formula | C13H11N3O |
| Molecular Weight | 225.25 g/mol |
| Exact Mass | 225.09 |
| IUPAC Name | 6,7-dimethyl-5-phenyloxadiazolo[5,4-b]pyridine |
| SMILES | Cc1c(-c2ccccc2)nc2onnc2c1C |
| InChI | InChI=1S/C13H11N3O/c1-8-9(2)12-13(17-16-15-12)14-11(8)10-6-4-3-5-7-10/h3-7H,1-2H3 |
| InChIKey | LLZAJEJFHXSYAE-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 51.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.25 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 6,7-dimethyl-5-phenyloxadiazolo[5,4-b]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6,7-dimethyl-5-phenyloxadiazolo[5,4-b]pyridine?
The IUPAC name of 6,7-dimethyl-5-phenyloxadiazolo[5,4-b]pyridine (CID 140681174) is 6,7-dimethyl-5-phenyloxadiazolo[5,4-b]pyridine.
What is the SMILES notation for 6,7-dimethyl-5-phenyloxadiazolo[5,4-b]pyridine?
The canonical SMILES for 6,7-dimethyl-5-phenyloxadiazolo[5,4-b]pyridine is Cc1c(-c2ccccc2)nc2onnc2c1C.
What is the InChIKey of 6,7-dimethyl-5-phenyloxadiazolo[5,4-b]pyridine?
The InChIKey is LLZAJEJFHXSYAE-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H11N3O/c1-8-9(2)12-13(17-16-15-12)14-11(8)10-6-4-3-5-7-10/h3-7H,1-2H3.
What are the key properties of 6,7-dimethyl-5-phenyloxadiazolo[5,4-b]pyridine?
6,7-dimethyl-5-phenyloxadiazolo[5,4-b]pyridine has a molecular weight of 225.25 g/mol, XLogP of 2.90, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6,7-dimethyl-5-phenyloxadiazolo[5,4-b]pyridine is sourced from PubChem (CID 140681174), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).