C14H28 — CID 140681309
(Z)-2,2,4,5,7,7-hexamethyloct-4-ene (PubChem CID 140681309) has the molecular formula C14H28 and a molecular weight of 196.38 g/mol. Its IUPAC name is (Z)-2,2,4,5,7,7-hexamethyloct-4-ene.
| Compound Name | (Z)-2,2,4,5,7,7-hexamethyloct-4-ene |
|---|---|
| PubChem CID | 140681309 |
| Molecular Formula | C14H28 |
| Molecular Weight | 196.38 g/mol |
| Exact Mass | 196.22 |
| IUPAC Name | (Z)-2,2,4,5,7,7-hexamethyloct-4-ene |
| SMILES | C/C(CC(C)(C)C)=C(\C)CC(C)(C)C |
| InChI | InChI=1S/C14H28/c1-11(9-13(3,4)5)12(2)10-14(6,7)8/h9-10H2,1-8H3/b12-11- |
| InChIKey | JBIATTXPWGLAKJ-QXMHVHEDSA-N |
| XLogP | 5.20 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.38 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|