C19H38O3Si — CID 140681811
tert-butyl-[(2R,5R,6E,8Z)-5-(methoxymethoxy)undeca-6,8-dien-2-yl]oxy-dimethylsilane (PubChem CID 140681811) has the molecular formula C19H38O3Si and a molecular weight of 342.60 g/mol. Its IUPAC name is tert-butyl-[(2R,5R,6E,8Z)-5-(methoxymethoxy)undeca-6,8-dien-2-yl]oxy-dimethylsilane.
| Compound Name | tert-butyl-[(2R,5R,6E,8Z)-5-(methoxymethoxy)undeca-6,8-dien-2-yl]oxy-dimethylsilane |
|---|---|
| PubChem CID | 140681811 |
| Molecular Formula | C19H38O3Si |
| Molecular Weight | 342.60 g/mol |
| Exact Mass | 342.26 |
| IUPAC Name | tert-butyl-[(2R,5R,6E,8Z)-5-(methoxymethoxy)undeca-6,8-dien-2-yl]oxy-dimethylsilane |
| SMILES | CC/C=C\C=C\[C@@H](CC[C@@H](C)O[Si](C)(C)C(C)(C)C)OCOC |
| InChI | InChI=1S/C19H38O3Si/c1-9-10-11-12-13-18(21-16-20-6)15-14-17(2)22-23(7,8)19(3,4)5/h10-13,17-18H,9,14-16H2,1-8H3/b11-10-,13-12+/t17-,18+/m1/s1 |
| InChIKey | XMUBCAQXHMVZMB-MLTPXVRRSA-N |
| XLogP | 5.69 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.60 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|