C20H16ClNO5 — CID 140681899
[5-benzamido-5-(4-chlorophenyl)-2-methyl-4-oxofuran-3-yl] acetate (PubChem CID 140681899) has the molecular formula C20H16ClNO5 and a molecular weight of 385.80 g/mol. Its IUPAC name is [5-benzamido-5-(4-chlorophenyl)-2-methyl-4-oxofuran-3-yl] acetate.
| Compound Name | [5-benzamido-5-(4-chlorophenyl)-2-methyl-4-oxofuran-3-yl] acetate |
|---|---|
| PubChem CID | 140681899 |
| Molecular Formula | C20H16ClNO5 |
| Molecular Weight | 385.80 g/mol |
| Exact Mass | 385.07 |
| IUPAC Name | [5-benzamido-5-(4-chlorophenyl)-2-methyl-4-oxofuran-3-yl] acetate |
| SMILES | CC(=O)OC1=C(C)OC(NC(=O)c2ccccc2)(c2ccc(Cl)cc2)C1=O |
| InChI | InChI=1S/C20H16ClNO5/c1-12-17(26-13(2)23)18(24)20(27-12,15-8-10-16(21)11-9-15)22-19(25)14-6-4-3-5-7-14/h3-11H,1-2H3,(H,22,25) |
| InChIKey | OBQVNQFQCMMQSD-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.80 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |