C35H28O4Si — CID 140682105
(2S)-2-[tert-butyl(dimethyl)silyl]oxy-2-[(4R,5R)-5-docosa-1,3,5,7,9,11,13,15,17,19,21-undecaynyl-2,2-dimethyl-1,3-dioxolan-4-yl]ethanol (PubChem CID 140682105) has the molecular formula C35H28O4Si and a molecular weight of 540.69 g/mol. Its IUPAC name is (2S)-2-[tert-butyl(dimethyl)silyl]oxy-2-[(4R,5R)-5-docosa-1,3,5,7,9,11,13,15,17,19,21-undecaynyl-2,2-dimethyl-1,3-dioxolan-4-yl]ethanol.
| Compound Name | (2S)-2-[tert-butyl(dimethyl)silyl]oxy-2-[(4R,5R)-5-docosa-1,3,5,7,9,11,13,15,17,19,21-undecaynyl-2,2-dimethyl-1,3-dioxolan-4-yl]ethanol |
|---|---|
| PubChem CID | 140682105 |
| Molecular Formula | C35H28O4Si |
| Molecular Weight | 540.69 g/mol |
| Exact Mass | 540.18 |
| IUPAC Name | (2S)-2-[tert-butyl(dimethyl)silyl]oxy-2-[(4R,5R)-5-docosa-1,3,5,7,9,11,13,15,17,19,21-undecaynyl-2,2-dimethyl-1,3-dioxolan-4-yl]ethanol |
| SMILES | C#CC#CC#CC#CC#CC#CC#CC#CC#CC#CC#C[C@H]1OC(C)(C)O[C@H]1[C@H](CO)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C35H28O4Si/c1-9-10-11-12-13-14-15-16-17-18-19-20-21-22-23-24-25-26-27-28-29-31-33(38-35(5,6)37-31)32(30-36)39-40(7,8)34(2,3)4/h1,31-33,36H,30H2,2-8H3/t31-,32+,33-/m1/s1 |
| InChIKey | OBJPAMWYGRFDAZ-XKKJXBDVSA-N |
| XLogP | 2.56 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.69 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|