C36H54N5O4S+ — CID 140682343
tert-butyl-[3-(2,2-dimethylpropyl)-7-[[4-[2-[[4-[(2,5-dioxopyrrol-1-yl)methyl]cyclohexanecarbonyl]amino]ethyl]piperazin-1-yl]methyl]-6-hydroxy-1H-indol-2-yl]sulfanium (PubChem CID 140682343) has the molecular formula C36H54N5O4S+ and a molecular weight of 652.93 g/mol. Its IUPAC name is tert-butyl-[3-(2,2-dimethylpropyl)-7-[[4-[2-[[4-[(2,5-dioxopyrrol-1-yl)methyl]cyclohexanecarbonyl]amino]ethyl]piperazin-1-yl]methyl]-6-hydroxy-1H-indol-2-yl]sulfanium.
| Compound Name | tert-butyl-[3-(2,2-dimethylpropyl)-7-[[4-[2-[[4-[(2,5-dioxopyrrol-1-yl)methyl]cyclohexanecarbonyl]amino]ethyl]piperazin-1-yl]methyl]-6-hydroxy-1H-indol-2-yl]sulfanium |
|---|---|
| PubChem CID | 140682343 |
| Molecular Formula | C36H54N5O4S+ |
| Molecular Weight | 652.93 g/mol |
| Exact Mass | 652.39 |
| IUPAC Name | tert-butyl-[3-(2,2-dimethylpropyl)-7-[[4-[2-[[4-[(2,5-dioxopyrrol-1-yl)methyl]cyclohexanecarbonyl]amino]ethyl]piperazin-1-yl]methyl]-6-hydroxy-1H-indol-2-yl]sulfanium |
| SMILES | CC(C)(C)Cc1c([SH+]C(C)(C)C)[nH]c2c(CN3CCN(CCNC(=O)C4CCC(CN5C(=O)C=CC5=O)CC4)CC3)c(O)ccc12 |
| InChI | InChI=1S/C36H53N5O4S/c1-35(2,3)21-27-26-11-12-29(42)28(32(26)38-34(27)46-36(4,5)6)23-40-19-17-39(18-20-40)16-15-37-33(45)25-9-7-24(8-10-25)22-41-30(43)13-14-31(41)44/h11-14,24-25,38,42H,7-10,15-23H2,1-6H3,(H,37,45)/p+1 |
| InChIKey | KEFFKOKZDRDUCW-UHFFFAOYSA-O |
| XLogP | 4.40 |
| TPSA | 108.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 652.93 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|